C15H20ClFN2 — CID 66078582
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-chloro-4-fluoroaniline (PubChem CID 66078582) has the molecular formula C15H20ClFN2 and a molecular weight of 282.79 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-chloro-4-fluoroaniline.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-chloro-4-fluoroaniline |
|---|---|
| PubChem CID | 66078582 |
| Molecular Formula | C15H20ClFN2 |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-5-chloro-4-fluoroaniline |
| SMILES | Nc1cc(Cl)c(F)cc1N1CCCC2CCCCC21 |
| InChI | InChI=1S/C15H20ClFN2/c16-11-8-13(18)15(9-12(11)17)19-7-3-5-10-4-1-2-6-14(10)19/h8-10,14H,1-7,18H2 |
| InChIKey | VFDAAYINDBKSMM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|