C11H10Br2N4O — CID 660786
2,4-dibromo-6-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol (PubChem CID 660786) has the molecular formula C11H10Br2N4O and a molecular weight of 374.04 g/mol. Its IUPAC name is 2,4-dibromo-6-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 660786 |
| Molecular Formula | C11H10Br2N4O |
| Molecular Weight | 374.04 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | 2,4-dibromo-6-[(3,5-dimethyl-1,2,4-triazol-4-yl)iminomethyl]phenol |
| SMILES | Cc1nnc(C)n1N=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C11H10Br2N4O/c1-6-15-16-7(2)17(6)14-5-8-3-9(12)4-10(13)11(8)18/h3-5,18H,1-2H3 |
| InChIKey | NZAFVHVKGSZJDY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.04 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|