C12H16ClFN2O — CID 66079185
4-chloro-5-fluoro-1-N-[2-(oxolan-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 66079185) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1-N-[2-(oxolan-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-5-fluoro-1-N-[2-(oxolan-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 66079185 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-chloro-5-fluoro-1-N-[2-(oxolan-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(F)cc1NCCC1CCCO1 |
| InChI | InChI=1S/C12H16ClFN2O/c13-9-6-11(15)12(7-10(9)14)16-4-3-8-2-1-5-17-8/h6-8,16H,1-5,15H2 |
| InChIKey | ZIKJEWJEKFLUMA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|