C12H15ClFN3O2 — CID 66079570
1-(4-chloro-5-fluoro-2-nitrophenyl)-2,5-dimethylpiperazine (PubChem CID 66079570) has the molecular formula C12H15ClFN3O2 and a molecular weight of 287.72 g/mol. Its IUPAC name is 1-(4-chloro-5-fluoro-2-nitrophenyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(4-chloro-5-fluoro-2-nitrophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 66079570 |
| Molecular Formula | C12H15ClFN3O2 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(4-chloro-5-fluoro-2-nitrophenyl)-2,5-dimethylpiperazine |
| SMILES | CC1CN(c2cc(F)c(Cl)cc2[N+](=O)[O-])C(C)CN1 |
| InChI | InChI=1S/C12H15ClFN3O2/c1-7-6-16(8(2)5-15-7)11-4-10(14)9(13)3-12(11)17(18)19/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | MSBUSZQNJKSLOW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|