C15H10ClF2IN2 — CID 66079847
2-(2-chloroethyl)-1-(2,5-difluorophenyl)-5-iodobenzimidazole (PubChem CID 66079847) has the molecular formula C15H10ClF2IN2 and a molecular weight of 418.61 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(2,5-difluorophenyl)-5-iodobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(2,5-difluorophenyl)-5-iodobenzimidazole |
|---|---|
| PubChem CID | 66079847 |
| Molecular Formula | C15H10ClF2IN2 |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 2-(2-chloroethyl)-1-(2,5-difluorophenyl)-5-iodobenzimidazole |
| SMILES | Fc1ccc(F)c(-n2c(CCCl)nc3cc(I)ccc32)c1 |
| InChI | InChI=1S/C15H10ClF2IN2/c16-6-5-15-20-12-8-10(19)2-4-13(12)21(15)14-7-9(17)1-3-11(14)18/h1-4,7-8H,5-6H2 |
| InChIKey | GGWYKPPHQKKYSQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|