C17H21IN2O — CID 66080150
4-iodo-1-N-[1-(2-methoxyphenyl)propan-2-yl]-1-N-methylbenzene-1,2-diamine (PubChem CID 66080150) has the molecular formula C17H21IN2O and a molecular weight of 396.27 g/mol. Its IUPAC name is 4-iodo-1-N-[1-(2-methoxyphenyl)propan-2-yl]-1-N-methylbenzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-[1-(2-methoxyphenyl)propan-2-yl]-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 66080150 |
| Molecular Formula | C17H21IN2O |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-iodo-1-N-[1-(2-methoxyphenyl)propan-2-yl]-1-N-methylbenzene-1,2-diamine |
| SMILES | COc1ccccc1CC(C)N(C)c1ccc(I)cc1N |
| InChI | InChI=1S/C17H21IN2O/c1-12(10-13-6-4-5-7-17(13)21-3)20(2)16-9-8-14(18)11-15(16)19/h4-9,11-12H,10,19H2,1-3H3 |
| InChIKey | COYNINWPOGCCJH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|