About 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea
1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 660808) has the molecular formula C12H14N4OS2
and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| PubChem CID | 660808 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCSc1nnc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C12H14N4OS2/c1-2-8-18-12-16-15-11(19-12)14-10(17)13-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,14,15,17) |
| InChIKey | PWTNCEOQVFAWLB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea?
The IUPAC name of 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea (CID 660808) is 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
What is the SMILES notation for 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea?
The canonical SMILES for 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea is CCCSc1nnc(NC(=O)Nc2ccccc2)s1.
What is the InChIKey of 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea?
The InChIKey is PWTNCEOQVFAWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS2/c1-2-8-18-12-16-15-11(19-12)14-10(17)13-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,14,15,17).
What are the key properties of 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea?
1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea has a molecular weight of 294.40 g/mol, XLogP of 3.68, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)urea is sourced from PubChem (CID 660808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).