C14H22IN3 — CID 66080908
5-iodo-2-[4-(2-methylpropyl)piperazin-1-yl]aniline (PubChem CID 66080908) has the molecular formula C14H22IN3 and a molecular weight of 359.26 g/mol. Its IUPAC name is 5-iodo-2-[4-(2-methylpropyl)piperazin-1-yl]aniline.
| Compound Name | 5-iodo-2-[4-(2-methylpropyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 66080908 |
| Molecular Formula | C14H22IN3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 5-iodo-2-[4-(2-methylpropyl)piperazin-1-yl]aniline |
| SMILES | CC(C)CN1CCN(c2ccc(I)cc2N)CC1 |
| InChI | InChI=1S/C14H22IN3/c1-11(2)10-17-5-7-18(8-6-17)14-4-3-12(15)9-13(14)16/h3-4,9,11H,5-8,10,16H2,1-2H3 |
| InChIKey | NCKDAWWGRPKLHA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|