C13H13ClF3IN2O — CID 66081859
2-(2-chloroethyl)-5-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazole (PubChem CID 66081859) has the molecular formula C13H13ClF3IN2O and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 66081859 |
| Molecular Formula | C13H13ClF3IN2O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | 2-(2-chloroethyl)-5-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazole |
| SMILES | FC(F)(F)COCCn1c(CCCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C13H13ClF3IN2O/c14-4-3-12-19-10-7-9(18)1-2-11(10)20(12)5-6-21-8-13(15,16)17/h1-2,7H,3-6,8H2 |
| InChIKey | QFNYZIMINKMTSQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|