C14H15ClIN5 — CID 66082053
2-(2-chloroethyl)-5-iodo-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole (PubChem CID 66082053) has the molecular formula C14H15ClIN5 and a molecular weight of 415.67 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-iodo-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-iodo-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 66082053 |
| Molecular Formula | C14H15ClIN5 |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 2-(2-chloroethyl)-5-iodo-1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzimidazole |
| SMILES | CC(c1nncn1C)n1c(CCCl)nc2cc(I)ccc21 |
| InChI | InChI=1S/C14H15ClIN5/c1-9(14-19-17-8-20(14)2)21-12-4-3-10(16)7-11(12)18-13(21)5-6-15/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | AYDIDVUDPCGSBV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|