C15H17ClIN3 — CID 66082440
2-(chloromethyl)-1-(1-cyclopropylpyrrolidin-3-yl)-5-iodobenzimidazole (PubChem CID 66082440) has the molecular formula C15H17ClIN3 and a molecular weight of 401.68 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(1-cyclopropylpyrrolidin-3-yl)-5-iodobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(1-cyclopropylpyrrolidin-3-yl)-5-iodobenzimidazole |
|---|---|
| PubChem CID | 66082440 |
| Molecular Formula | C15H17ClIN3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-(chloromethyl)-1-(1-cyclopropylpyrrolidin-3-yl)-5-iodobenzimidazole |
| SMILES | ClCc1nc2cc(I)ccc2n1C1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H17ClIN3/c16-8-15-18-13-7-10(17)1-4-14(13)20(15)12-5-6-19(9-12)11-2-3-11/h1,4,7,11-12H,2-3,5-6,8-9H2 |
| InChIKey | OYDLMFWDKXMZSB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|