C11H12F3N3O4 — CID 66083143
4-[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]piperazine-2,6-dione (PubChem CID 66083143) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is 4-[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]piperazine-2,6-dione.
| Compound Name | 4-[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66083143 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)C2CC(=O)N(CC(F)(F)F)C2)CC(=O)N1 |
| InChI | InChI=1S/C11H12F3N3O4/c12-11(13,14)5-17-2-6(1-9(17)20)10(21)16-3-7(18)15-8(19)4-16/h6H,1-5H2,(H,15,18,19) |
| InChIKey | YQWWQRLDJVNCOT-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|