C13H13BrN2O5 — CID 66083393
4-(4-bromo-3,5-dimethoxybenzoyl)piperazine-2,6-dione (PubChem CID 66083393) has the molecular formula C13H13BrN2O5 and a molecular weight of 357.16 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethoxybenzoyl)piperazine-2,6-dione.
| Compound Name | 4-(4-bromo-3,5-dimethoxybenzoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66083393 |
| Molecular Formula | C13H13BrN2O5 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 4-(4-bromo-3,5-dimethoxybenzoyl)piperazine-2,6-dione |
| SMILES | COc1cc(C(=O)N2CC(=O)NC(=O)C2)cc(OC)c1Br |
| InChI | InChI=1S/C13H13BrN2O5/c1-20-8-3-7(4-9(21-2)12(8)14)13(19)16-5-10(17)15-11(18)6-16/h3-4H,5-6H2,1-2H3,(H,15,17,18) |
| InChIKey | XKRNSCZNKFVBOO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|