About 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde
2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde (PubChem CID 66083550) has the molecular formula C11H9ClN2O3
and a molecular weight of 252.66 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde.
Molecular Properties
| Compound Name | 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde |
| PubChem CID | 66083550 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde |
| SMILES | O=Cc1c(Cl)cccc1N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H9ClN2O3/c12-8-2-1-3-9(7(8)6-15)14-4-10(16)13-11(17)5-14/h1-3,6H,4-5H2,(H,13,16,17) |
| InChIKey | DXFSQUXKKSVNGF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde?
The IUPAC name of 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde (CID 66083550) is 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde.
What is the SMILES notation for 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde?
The canonical SMILES for 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde is O=Cc1c(Cl)cccc1N1CC(=O)NC(=O)C1.
What is the InChIKey of 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde?
The InChIKey is DXFSQUXKKSVNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O3/c12-8-2-1-3-9(7(8)6-15)14-4-10(16)13-11(17)5-14/h1-3,6H,4-5H2,(H,13,16,17).
What are the key properties of 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde?
2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde has a molecular weight of 252.66 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(3,5-dioxopiperazin-1-yl)benzaldehyde is sourced from PubChem (CID 66083550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).