C21H28N2O5 — CID 6608419
2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide (PubChem CID 6608419) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 6608419 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[(2S,6R)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@H](CO)NC(=O)C[C@H]1CC=CCCC(=O)O[C@@H](c2ccccc2)CNC1=O |
| InChI | InChI=1S/C21H28N2O5/c1-15(14-24)23-19(25)12-17-10-6-3-7-11-20(26)28-18(13-22-21(17)27)16-8-4-2-5-9-16/h2-6,8-9,15,17-18,24H,7,10-14H2,1H3,(H,22,27)(H,23,25)/t15-,17-,18-/m1/s1 |
| InChIKey | OZGHJHNQBFQYNW-KBAYOESNSA-N |
| XLogP | 1.63 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|