C8H11N3O4 — CID 66084386
N-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide (PubChem CID 66084386) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is N-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | N-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 66084386 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C8H11N3O4/c1-5(12)9-2-8(15)11-3-6(13)10-7(14)4-11/h2-4H2,1H3,(H,9,12)(H,10,13,14) |
| InChIKey | XHLVUKIAHGDUDX-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|