About 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide
4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 66084496) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide.
Molecular Properties
| Compound Name | 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide |
| PubChem CID | 66084496 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCN1CC(=O)NC(=O)C1)C(N)=S |
| InChI | InChI=1S/C10H17N3O2S/c1-10(2,9(11)16)3-4-13-5-7(14)12-8(15)6-13/h3-6H2,1-2H3,(H2,11,16)(H,12,14,15) |
| InChIKey | DNMGHHITWLKPCL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide?
The IUPAC name of 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide (CID 66084496) is 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide.
What is the SMILES notation for 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide?
The canonical SMILES for 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide is CC(C)(CCN1CC(=O)NC(=O)C1)C(N)=S.
What is the InChIKey of 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide?
The InChIKey is DNMGHHITWLKPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-10(2,9(11)16)3-4-13-5-7(14)12-8(15)6-13/h3-6H2,1-2H3,(H2,11,16)(H,12,14,15).
What are the key properties of 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide?
4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide has a molecular weight of 243.33 g/mol, XLogP of -0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide is sourced from PubChem (CID 66084496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).