C15H12N2O4 — CID 66084701
4-(3-phenylfuran-2-carbonyl)piperazine-2,6-dione (PubChem CID 66084701) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-(3-phenylfuran-2-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(3-phenylfuran-2-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084701 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(3-phenylfuran-2-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2occc2-c2ccccc2)CC(=O)N1 |
| InChI | InChI=1S/C15H12N2O4/c18-12-8-17(9-13(19)16-12)15(20)14-11(6-7-21-14)10-4-2-1-3-5-10/h1-7H,8-9H2,(H,16,18,19) |
| InChIKey | MGCDXDMYLFMNRQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|