C11H12ClN3O2 — CID 66084854
4-[(3-amino-4-chlorophenyl)methyl]piperazine-2,6-dione (PubChem CID 66084854) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 4-[(3-amino-4-chlorophenyl)methyl]piperazine-2,6-dione.
| Compound Name | 4-[(3-amino-4-chlorophenyl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084854 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 4-[(3-amino-4-chlorophenyl)methyl]piperazine-2,6-dione |
| SMILES | Nc1cc(CN2CC(=O)NC(=O)C2)ccc1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c12-8-2-1-7(3-9(8)13)4-15-5-10(16)14-11(17)6-15/h1-3H,4-6,13H2,(H,14,16,17) |
| InChIKey | HZPNQKHYIHYHSA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|