C10H16N4O3 — CID 66084891
4-(2-oxo-2-piperazin-1-ylethyl)piperazine-2,6-dione (PubChem CID 66084891) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(2-oxo-2-piperazin-1-ylethyl)piperazine-2,6-dione.
| Compound Name | 4-(2-oxo-2-piperazin-1-ylethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084891 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-(2-oxo-2-piperazin-1-ylethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(CC(=O)N2CCNCC2)CC(=O)N1 |
| InChI | InChI=1S/C10H16N4O3/c15-8-5-13(6-9(16)12-8)7-10(17)14-3-1-11-2-4-14/h11H,1-7H2,(H,12,15,16) |
| InChIKey | MNWFSGWWIWFUGX-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|