About 5-(3,5-dioxopiperazin-1-yl)pentanenitrile
5-(3,5-dioxopiperazin-1-yl)pentanenitrile (PubChem CID 66085661) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 5-(3,5-dioxopiperazin-1-yl)pentanenitrile.
Molecular Properties
| Compound Name | 5-(3,5-dioxopiperazin-1-yl)pentanenitrile |
| PubChem CID | 66085661 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 5-(3,5-dioxopiperazin-1-yl)pentanenitrile |
| SMILES | N#CCCCCN1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C9H13N3O2/c10-4-2-1-3-5-12-6-8(13)11-9(14)7-12/h1-3,5-7H2,(H,11,13,14) |
| InChIKey | YAECZVPREPOBNY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dioxopiperazin-1-yl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dioxopiperazin-1-yl)pentanenitrile?
The IUPAC name of 5-(3,5-dioxopiperazin-1-yl)pentanenitrile (CID 66085661) is 5-(3,5-dioxopiperazin-1-yl)pentanenitrile.
What is the SMILES notation for 5-(3,5-dioxopiperazin-1-yl)pentanenitrile?
The canonical SMILES for 5-(3,5-dioxopiperazin-1-yl)pentanenitrile is N#CCCCCN1CC(=O)NC(=O)C1.
What is the InChIKey of 5-(3,5-dioxopiperazin-1-yl)pentanenitrile?
The InChIKey is YAECZVPREPOBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c10-4-2-1-3-5-12-6-8(13)11-9(14)7-12/h1-3,5-7H2,(H,11,13,14).
What are the key properties of 5-(3,5-dioxopiperazin-1-yl)pentanenitrile?
5-(3,5-dioxopiperazin-1-yl)pentanenitrile has a molecular weight of 195.22 g/mol, XLogP of -0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dioxopiperazin-1-yl)pentanenitrile is sourced from PubChem (CID 66085661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).