C16H19ClN2S — CID 66087152
4-chloro-6-methyl-2-[(3-methylphenyl)sulfanylmethyl]-5-propan-2-ylpyrimidine (PubChem CID 66087152) has the molecular formula C16H19ClN2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-[(3-methylphenyl)sulfanylmethyl]-5-propan-2-ylpyrimidine.
| Compound Name | 4-chloro-6-methyl-2-[(3-methylphenyl)sulfanylmethyl]-5-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 66087152 |
| Molecular Formula | C16H19ClN2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-chloro-6-methyl-2-[(3-methylphenyl)sulfanylmethyl]-5-propan-2-ylpyrimidine |
| SMILES | Cc1cccc(SCc2nc(C)c(C(C)C)c(Cl)n2)c1 |
| InChI | InChI=1S/C16H19ClN2S/c1-10(2)15-12(4)18-14(19-16(15)17)9-20-13-7-5-6-11(3)8-13/h5-8,10H,9H2,1-4H3 |
| InChIKey | IDNAFFFBYVDGPM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |