C13H7BrF3N3 — CID 66087851
5-bromo-1-(2,5-difluorophenyl)-6-fluorobenzimidazol-2-amine (PubChem CID 66087851) has the molecular formula C13H7BrF3N3 and a molecular weight of 342.12 g/mol. Its IUPAC name is 5-bromo-1-(2,5-difluorophenyl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-bromo-1-(2,5-difluorophenyl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66087851 |
| Molecular Formula | C13H7BrF3N3 |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 5-bromo-1-(2,5-difluorophenyl)-6-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)c(F)cc2n1-c1cc(F)ccc1F |
| InChI | InChI=1S/C13H7BrF3N3/c14-7-4-10-12(5-9(7)17)20(13(18)19-10)11-3-6(15)1-2-8(11)16/h1-5H,(H2,18,19) |
| InChIKey | LVVZSLOETMPNQV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |