C13H19NS — CID 66088350
N-methyl-1-(3-methylphenyl)sulfanylpent-4-en-2-amine (PubChem CID 66088350) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-methyl-1-(3-methylphenyl)sulfanylpent-4-en-2-amine.
| Compound Name | N-methyl-1-(3-methylphenyl)sulfanylpent-4-en-2-amine |
|---|---|
| PubChem CID | 66088350 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-methyl-1-(3-methylphenyl)sulfanylpent-4-en-2-amine |
| SMILES | C=CCC(CSc1cccc(C)c1)NC |
| InChI | InChI=1S/C13H19NS/c1-4-6-12(14-3)10-15-13-8-5-7-11(2)9-13/h4-5,7-9,12,14H,1,6,10H2,2-3H3 |
| InChIKey | NCPZJCRKEUNANP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|