C9H8F4O4 — CID 660901
5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxylic acid (PubChem CID 660901) has the molecular formula C9H8F4O4 and a molecular weight of 256.15 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxylic acid.
| Compound Name | 5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 660901 |
| Molecular Formula | C9H8F4O4 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C9H8F4O4/c10-8(11)9(12,13)4-16-3-5-1-2-6(17-5)7(14)15/h1-2,8H,3-4H2,(H,14,15) |
| InChIKey | LWEHCQLIQPPYDE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|