About 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine
4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine (PubChem CID 66090861) has the molecular formula C7H14ClF2N
and a molecular weight of 185.64 g/mol. Its IUPAC name is 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine |
| PubChem CID | 66090861 |
| Molecular Formula | C7H14ClF2N |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine |
| SMILES | CC(CCCl)CNCC(F)F |
| InChI | InChI=1S/C7H14ClF2N/c1-6(2-3-8)4-11-5-7(9)10/h6-7,11H,2-5H2,1H3 |
| InChIKey | AVGAJPMBZRMBDK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine?
The IUPAC name of 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine (CID 66090861) is 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine.
What is the SMILES notation for 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine?
The canonical SMILES for 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine is CC(CCCl)CNCC(F)F.
What is the InChIKey of 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine?
The InChIKey is AVGAJPMBZRMBDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClF2N/c1-6(2-3-8)4-11-5-7(9)10/h6-7,11H,2-5H2,1H3.
What are the key properties of 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine?
4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine has a molecular weight of 185.64 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-difluoroethyl)-2-methylbutan-1-amine is sourced from PubChem (CID 66090861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).