C30H38N2O5 — CID 6609089
2-[(3R,6R,12R)-3,12-dibenzyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 6609089) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[(3R,6R,12R)-3,12-dibenzyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[(3R,6R,12R)-3,12-dibenzyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 6609089 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 2-[(3R,6R,12R)-3,12-dibenzyl-5,13-dioxo-1-oxa-4-azacyclotridec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)C[C@H]1CC=CCC[C@H](Cc2ccccc2)C(=O)OC[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C30H38N2O5/c1-22(20-33)31-28(34)19-25-15-9-4-10-16-26(17-23-11-5-2-6-12-23)30(36)37-21-27(32-29(25)35)18-24-13-7-3-8-14-24/h2-9,11-14,22,25-27,33H,10,15-21H2,1H3,(H,31,34)(H,32,35)/t22-,25+,26+,27+/m0/s1 |
| InChIKey | QMAYEUXLIXSVFY-KVVRFYPFSA-N |
| XLogP | 3.36 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|