C13H16F3N3O3S — CID 660917
methyl 2-acetamido-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate (PubChem CID 660917) has the molecular formula C13H16F3N3O3S and a molecular weight of 351.35 g/mol. Its IUPAC name is methyl 2-acetamido-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate.
| Compound Name | methyl 2-acetamido-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 660917 |
| Molecular Formula | C13H16F3N3O3S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | methyl 2-acetamido-3,3,3-trifluoro-2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1nc2c(s1)CCCC2)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O3S/c1-7(20)18-12(10(21)22-2,13(14,15)16)19-11-17-8-5-3-4-6-9(8)23-11/h3-6H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ZOXYLXQHVJITPM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|