C21H36N2O5 — CID 6609231
2-[(3S,6R)-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 6609231) has the molecular formula C21H36N2O5 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[(3S,6R)-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[(3S,6R)-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 6609231 |
| Molecular Formula | C21H36N2O5 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(3S,6R)-3-tert-butyl-5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)C[C@H]1CC=CCCCCC(=O)OC[C@H](C(C)(C)C)NC1=O |
| InChI | InChI=1S/C21H36N2O5/c1-15(13-24)22-18(25)12-16-10-8-6-5-7-9-11-19(26)28-14-17(21(2,3)4)23-20(16)27/h6,8,15-17,24H,5,7,9-14H2,1-4H3,(H,22,25)(H,23,27)/t15-,16+,17+/m0/s1 |
| InChIKey | IKRGPQLOVZGSJD-GVDBMIGSSA-N |
| XLogP | 2.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|