C15H16IN3 — CID 66092951
3-iodo-4-(4-methyl-2,3-dihydroquinoxalin-1-yl)aniline (PubChem CID 66092951) has the molecular formula C15H16IN3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 3-iodo-4-(4-methyl-2,3-dihydroquinoxalin-1-yl)aniline.
| Compound Name | 3-iodo-4-(4-methyl-2,3-dihydroquinoxalin-1-yl)aniline |
|---|---|
| PubChem CID | 66092951 |
| Molecular Formula | C15H16IN3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 3-iodo-4-(4-methyl-2,3-dihydroquinoxalin-1-yl)aniline |
| SMILES | CN1CCN(c2ccc(N)cc2I)c2ccccc21 |
| InChI | InChI=1S/C15H16IN3/c1-18-8-9-19(15-5-3-2-4-14(15)18)13-7-6-11(17)10-12(13)16/h2-7,10H,8-9,17H2,1H3 |
| InChIKey | IYVDVSRXWJBLSJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|