C12H16IN3O — CID 66093578
5-(4-amino-2-iodoanilino)-1-methylpiperidin-2-one (PubChem CID 66093578) has the molecular formula C12H16IN3O and a molecular weight of 345.18 g/mol. Its IUPAC name is 5-(4-amino-2-iodoanilino)-1-methylpiperidin-2-one.
| Compound Name | 5-(4-amino-2-iodoanilino)-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 66093578 |
| Molecular Formula | C12H16IN3O |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5-(4-amino-2-iodoanilino)-1-methylpiperidin-2-one |
| SMILES | CN1CC(Nc2ccc(N)cc2I)CCC1=O |
| InChI | InChI=1S/C12H16IN3O/c1-16-7-9(3-5-12(16)17)15-11-4-2-8(14)6-10(11)13/h2,4,6,9,15H,3,5,7,14H2,1H3 |
| InChIKey | ULFQWQZOVZFHFG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|