C21H34N2O5 — CID 6609473
2-[(8R)-7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 6609473) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[(8R)-7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[(8R)-7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 6609473 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[(8R)-7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)C[C@H]1CC=CCCCCC(=O)OCC2(CCCC2)NC1=O |
| InChI | InChI=1S/C21H34N2O5/c1-16(14-24)22-18(25)13-17-9-5-3-2-4-6-10-19(26)28-15-21(23-20(17)27)11-7-8-12-21/h3,5,16-17,24H,2,4,6-15H2,1H3,(H,22,25)(H,23,27)/t16-,17+/m0/s1 |
| InChIKey | JNSSBHFUTDNNGZ-DLBZAZTESA-N |
| XLogP | 1.98 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|