C16H13F3OS — CID 66095873
2-(2-methylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 66095873) has the molecular formula C16H13F3OS and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-(2-methylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(2-methylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 66095873 |
| Molecular Formula | C16H13F3OS |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-(2-methylphenyl)sulfanyl-1-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | Cc1ccccc1SCC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3OS/c1-11-4-2-3-5-15(11)21-10-14(20)12-6-8-13(9-7-12)16(17,18)19/h2-9H,10H2,1H3 |
| InChIKey | FRPNHIDZIQXLSJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |