About 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid
2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid (PubChem CID 66098146) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid |
| PubChem CID | 66098146 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid |
| SMILES | CC(N)C1(CC(=O)O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c1-6(9)8(4-7(10)11)2-3-14(12,13)5-8/h6H,2-5,9H2,1H3,(H,10,11) |
| InChIKey | QSKONPQOIJXKKS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The IUPAC name of 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid (CID 66098146) is 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid.
What is the SMILES notation for 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The canonical SMILES for 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid is CC(N)C1(CC(=O)O)CCS(=O)(=O)C1.
What is the InChIKey of 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The InChIKey is QSKONPQOIJXKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-6(9)8(4-7(10)11)2-3-14(12,13)5-8/h6H,2-5,9H2,1H3,(H,10,11).
What are the key properties of 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid?
2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid has a molecular weight of 221.28 g/mol, XLogP of -0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-aminoethyl)-1,1-dioxothiolan-3-yl]acetic acid is sourced from PubChem (CID 66098146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).