C16H25NO4 — CID 66098150
methyl 4-amino-3-(2,5-dimethoxyphenyl)-3-methylhexanoate (PubChem CID 66098150) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl 4-amino-3-(2,5-dimethoxyphenyl)-3-methylhexanoate.
| Compound Name | methyl 4-amino-3-(2,5-dimethoxyphenyl)-3-methylhexanoate |
|---|---|
| PubChem CID | 66098150 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | methyl 4-amino-3-(2,5-dimethoxyphenyl)-3-methylhexanoate |
| SMILES | CCC(N)C(C)(CC(=O)OC)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H25NO4/c1-6-14(17)16(2,10-15(18)21-5)12-9-11(19-3)7-8-13(12)20-4/h7-9,14H,6,10,17H2,1-5H3 |
| InChIKey | DIIANMHDSCHSNJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |