methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate

C11H21NO4S — CID 66098152

IUPACmethyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate
SMILESCCC(N)C1(CC(=O)OC)CCCS(=O)(=O)C1
InChIInChI=1S/C11H21NO4S/c1-3-9(12)11(7-10(13)16-2)5-4-6-17(14,15)8-11/h9H,3-8,12H2,1-2H3
InChIKeyZEOXIHADEFJFBN-UHFFFAOYSA-N
MW263.36 g/mol
LogP0.48
Rot. Bonds4

About methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate

methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate (PubChem CID 66098152) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate
PubChem CID66098152
Molecular FormulaC11H21NO4S
Molecular Weight263.36 g/mol
Exact Mass263.12
IUPAC Namemethyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate
SMILESCCC(N)C1(CC(=O)OC)CCCS(=O)(=O)C1
InChIInChI=1S/C11H21NO4S/c1-3-9(12)11(7-10(13)16-2)5-4-6-17(14,15)8-11/h9H,3-8,12H2,1-2H3
InChIKeyZEOXIHADEFJFBN-UHFFFAOYSA-N
XLogP0.48
TPSA86.46 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.36
LogP ≤ 50.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The IUPAC name of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate (CID 66098152) is methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate.
What is the SMILES notation for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The canonical SMILES for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate is CCC(N)C1(CC(=O)OC)CCCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The InChIKey is ZEOXIHADEFJFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S/c1-3-9(12)11(7-10(13)16-2)5-4-6-17(14,15)8-11/h9H,3-8,12H2,1-2H3.
What are the key properties of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate has a molecular weight of 263.36 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate is sourced from PubChem (CID 66098152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).