About methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate
methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate (PubChem CID 66098152) has the molecular formula C11H21NO4S
and a molecular weight of 263.36 g/mol. Its IUPAC name is methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate |
| PubChem CID | 66098152 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate |
| SMILES | CCC(N)C1(CC(=O)OC)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-3-9(12)11(7-10(13)16-2)5-4-6-17(14,15)8-11/h9H,3-8,12H2,1-2H3 |
| InChIKey | ZEOXIHADEFJFBN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The IUPAC name of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate (CID 66098152) is methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate.
What is the SMILES notation for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The canonical SMILES for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate is CCC(N)C1(CC(=O)OC)CCCS(=O)(=O)C1.
What is the InChIKey of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
The InChIKey is ZEOXIHADEFJFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S/c1-3-9(12)11(7-10(13)16-2)5-4-6-17(14,15)8-11/h9H,3-8,12H2,1-2H3.
What are the key properties of methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate?
methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate has a molecular weight of 263.36 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(1-aminopropyl)-1,1-dioxothian-3-yl]acetate is sourced from PubChem (CID 66098152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).