About 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline
4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline (PubChem CID 66099779) has the molecular formula C8H5FIN3S2
and a molecular weight of 353.19 g/mol. Its IUPAC name is 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline.
Molecular Properties
| Compound Name | 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
| PubChem CID | 66099779 |
| Molecular Formula | C8H5FIN3S2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.90 |
| IUPAC Name | 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline |
| SMILES | Nc1cc(I)c(F)cc1Sc1nncs1 |
| InChI | InChI=1S/C8H5FIN3S2/c9-4-1-7(6(11)2-5(4)10)15-8-13-12-3-14-8/h1-3H,11H2 |
| InChIKey | DXYZZAIPAAJRRL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline?
The IUPAC name of 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline (CID 66099779) is 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline.
What is the SMILES notation for 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline?
The canonical SMILES for 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline is Nc1cc(I)c(F)cc1Sc1nncs1.
What is the InChIKey of 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline?
The InChIKey is DXYZZAIPAAJRRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FIN3S2/c9-4-1-7(6(11)2-5(4)10)15-8-13-12-3-14-8/h1-3H,11H2.
What are the key properties of 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline?
4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline has a molecular weight of 353.19 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-iodo-2-(1,3,4-thiadiazol-2-ylsulfanyl)aniline is sourced from PubChem (CID 66099779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).