About 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide
4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 661004) has the molecular formula C16H15ClN4OS
and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 661004 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3nccs3)cc2)c(C)c1Cl |
| InChI | InChI=1S/C16H15ClN4OS/c1-10-14(17)11(2)21(20-10)9-12-3-5-13(6-4-12)15(22)19-16-18-7-8-23-16/h3-8H,9H2,1-2H3,(H,18,19,22) |
| InChIKey | QXGQILWUEPFTRO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide (CID 661004) is 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide is Cc1nn(Cc2ccc(C(=O)Nc3nccs3)cc2)c(C)c1Cl.
What is the InChIKey of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is QXGQILWUEPFTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4OS/c1-10-14(17)11(2)21(20-10)9-12-3-5-13(6-4-12)15(22)19-16-18-7-8-23-16/h3-8H,9H2,1-2H3,(H,18,19,22).
What are the key properties of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide?
4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 346.84 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 661004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).