C27H21FN4O3 — CID 6610124
4-[[1-(2-fluoroanilino)-5,7-dioxo-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridin-2-yl]-hydroxymethyl]benzonitrile (PubChem CID 6610124) has the molecular formula C27H21FN4O3 and a molecular weight of 468.49 g/mol. Its IUPAC name is 4-[[1-(2-fluoroanilino)-5,7-dioxo-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridin-2-yl]-hydroxymethyl]benzonitrile.
| Compound Name | 4-[[1-(2-fluoroanilino)-5,7-dioxo-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridin-2-yl]-hydroxymethyl]benzonitrile |
|---|---|
| PubChem CID | 6610124 |
| Molecular Formula | C27H21FN4O3 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-[[1-(2-fluoroanilino)-5,7-dioxo-6-phenyl-4a,7a-dihydro-2H-pyrrolo[3,4-b]pyridin-2-yl]-hydroxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(C(O)C2C=CC3C(=O)N(c4ccccc4)C(=O)C3N2Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C27H21FN4O3/c28-21-8-4-5-9-22(21)30-32-23(25(33)18-12-10-17(16-29)11-13-18)15-14-20-24(32)27(35)31(26(20)34)19-6-2-1-3-7-19/h1-15,20,23-25,30,33H |
| InChIKey | IXVJPPQMRDAVAO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|