C31H35N3O6S — CID 6610139
ethyl (2S,6S)-2-[4-(diethylamino)phenyl]-1-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 6610139) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is ethyl (2S,6S)-2-[4-(diethylamino)phenyl]-1-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl (2S,6S)-2-[4-(diethylamino)phenyl]-1-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 6610139 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | ethyl (2S,6S)-2-[4-(diethylamino)phenyl]-1-(4-methylphenyl)sulfonyl-6-(4-nitrophenyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](c2ccc(N(CC)CC)cc2)N(S(=O)(=O)c2ccc(C)cc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H35N3O6S/c1-5-32(6-2)25-14-10-23(11-15-25)29-21-20-28(31(35)40-7-3)30(24-12-16-26(17-13-24)34(36)37)33(29)41(38,39)27-18-8-22(4)9-19-27/h8-20,29-30H,5-7,21H2,1-4H3/t29-,30-/m0/s1 |
| InChIKey | NRQRKHUSOKASMQ-KYJUHHDHSA-N |
| XLogP | 6.12 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|