C21H20Ac2O4-2 — CID 6610172
actinium;propan-2-yl 2-[(2R,6S)-2,6-di(phenyl)-1,3-dioxan-4-ylidene]acetate (PubChem CID 6610172) has the molecular formula C21H20Ac2O4-2 and a molecular weight of 790.39 g/mol. Its IUPAC name is actinium;propan-2-yl 2-[(2R,6S)-2,6-di(phenyl)-1,3-dioxan-4-ylidene]acetate.
| Compound Name | actinium;propan-2-yl 2-[(2R,6S)-2,6-di(phenyl)-1,3-dioxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 6610172 |
| Molecular Formula | C21H20Ac2O4-2 |
| Molecular Weight | 790.39 g/mol |
| Exact Mass | 790.19 |
| IUPAC Name | actinium;propan-2-yl 2-[(2R,6S)-2,6-di(phenyl)-1,3-dioxan-4-ylidene]acetate |
| SMILES | CC(C)OC(=O)C=C1C[C@@H](c2cc[c-]cc2)O[C@@H](c2cc[c-]cc2)O1.[Ac].[Ac] |
| InChI | InChI=1S/C21H20O4.2Ac/c1-15(2)23-20(22)14-18-13-19(16-9-5-3-6-10-16)25-21(24-18)17-11-7-4-8-12-17;;/h5-12,14-15,19,21H,13H2,1-2H3;;/q-2;;/t19-,21-;;/m0../s1 |
| InChIKey | FBDKOQZPVGMWGE-ANXDEKAJSA-N |
| XLogP | 4.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|