C15H19FIN3 — CID 66101762
1-(2,3-dimethylcyclohexyl)-6-fluoro-5-iodobenzimidazol-2-amine (PubChem CID 66101762) has the molecular formula C15H19FIN3 and a molecular weight of 387.24 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclohexyl)-6-fluoro-5-iodobenzimidazol-2-amine.
| Compound Name | 1-(2,3-dimethylcyclohexyl)-6-fluoro-5-iodobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66101762 |
| Molecular Formula | C15H19FIN3 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 1-(2,3-dimethylcyclohexyl)-6-fluoro-5-iodobenzimidazol-2-amine |
| SMILES | CC1CCCC(n2c(N)nc3cc(I)c(F)cc32)C1C |
| InChI | InChI=1S/C15H19FIN3/c1-8-4-3-5-13(9(8)2)20-14-6-10(16)11(17)7-12(14)19-15(20)18/h6-9,13H,3-5H2,1-2H3,(H2,18,19) |
| InChIKey | YYERSGLPHCTBIC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|