About dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate
dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate (PubChem CID 6610205) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate |
| PubChem CID | 6610205 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate |
| SMILES | C=CC1(C(=O)OC)CC=C(C(=O)OC)CC1 |
| InChI | InChI=1S/C12H16O4/c1-4-12(11(14)16-3)7-5-9(6-8-12)10(13)15-2/h4-5H,1,6-8H2,2-3H3 |
| InChIKey | RIGUZPJADDDISE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate?
The IUPAC name of dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate (CID 6610205) is dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate.
What is the SMILES notation for dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate?
The canonical SMILES for dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate is C=CC1(C(=O)OC)CC=C(C(=O)OC)CC1.
What is the InChIKey of dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate?
The InChIKey is RIGUZPJADDDISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-4-12(11(14)16-3)7-5-9(6-8-12)10(13)15-2/h4-5H,1,6-8H2,2-3H3.
What are the key properties of dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate?
dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-ethenylcyclohexene-1,4-dicarboxylate is sourced from PubChem (CID 6610205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).