C12H13FIN3O2 — CID 66102230
(3aS,6aS)-1-(5-fluoro-4-iodo-2-nitrophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 66102230) has the molecular formula C12H13FIN3O2 and a molecular weight of 377.16 g/mol. Its IUPAC name is (3aS,6aS)-1-(5-fluoro-4-iodo-2-nitrophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-1-(5-fluoro-4-iodo-2-nitrophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 66102230 |
| Molecular Formula | C12H13FIN3O2 |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (3aS,6aS)-1-(5-fluoro-4-iodo-2-nitrophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | O=[N+]([O-])c1cc(I)c(F)cc1N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C12H13FIN3O2/c13-8-3-10(11(17(18)19)4-9(8)14)16-2-1-7-5-15-6-12(7)16/h3-4,7,12,15H,1-2,5-6H2/t7-,12+/m0/s1 |
| InChIKey | FRGJFHDXGDRGSY-JVXZTZIISA-N |
| XLogP | 2.14 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|