About 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine
2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine (PubChem CID 66102264) has the molecular formula C12H18FIN2
and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine |
| PubChem CID | 66102264 |
| Molecular Formula | C12H18FIN2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine |
| SMILES | CN(CC(C)(C)C)c1cc(F)c(I)cc1N |
| InChI | InChI=1S/C12H18FIN2/c1-12(2,3)7-16(4)11-5-8(13)9(14)6-10(11)15/h5-6H,7,15H2,1-4H3 |
| InChIKey | ADFZOIPZHWMLGG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine?
The IUPAC name of 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine (CID 66102264) is 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine.
What is the SMILES notation for 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine?
The canonical SMILES for 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine is CN(CC(C)(C)C)c1cc(F)c(I)cc1N.
What is the InChIKey of 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine?
The InChIKey is ADFZOIPZHWMLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FIN2/c1-12(2,3)7-16(4)11-5-8(13)9(14)6-10(11)15/h5-6H,7,15H2,1-4H3.
What are the key properties of 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine?
2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine has a molecular weight of 336.19 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2,2-dimethylpropyl)-4-fluoro-5-iodo-2-N-methylbenzene-1,2-diamine is sourced from PubChem (CID 66102264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).