About benzene;5,5-dimethylimidazolidine-2,4-dione
benzene;5,5-dimethylimidazolidine-2,4-dione (PubChem CID 6610245) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is benzene;5,5-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | benzene;5,5-dimethylimidazolidine-2,4-dione |
| PubChem CID | 6610245 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | benzene;5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)NC1=O.c1ccccc1 |
| InChI | InChI=1S/C6H6.C5H8N2O2/c1-2-4-6-5-3-1;1-5(2)3(8)6-4(9)7-5/h1-6H;1-2H3,(H2,6,7,8,9) |
| InChIKey | IQVHNPCZIMHCLD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze benzene;5,5-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;5,5-dimethylimidazolidine-2,4-dione?
The IUPAC name of benzene;5,5-dimethylimidazolidine-2,4-dione (CID 6610245) is benzene;5,5-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for benzene;5,5-dimethylimidazolidine-2,4-dione?
The canonical SMILES for benzene;5,5-dimethylimidazolidine-2,4-dione is CC1(C)NC(=O)NC1=O.c1ccccc1.
What is the InChIKey of benzene;5,5-dimethylimidazolidine-2,4-dione?
The InChIKey is IQVHNPCZIMHCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C5H8N2O2/c1-2-4-6-5-3-1;1-5(2)3(8)6-4(9)7-5/h1-6H;1-2H3,(H2,6,7,8,9).
What are the key properties of benzene;5,5-dimethylimidazolidine-2,4-dione?
benzene;5,5-dimethylimidazolidine-2,4-dione has a molecular weight of 206.25 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;5,5-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 6610245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).