About N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide
N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide (PubChem CID 6610273) has the molecular formula C20H41NO3
and a molecular weight of 343.55 g/mol. Its IUPAC name is N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide |
| PubChem CID | 6610273 |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide |
| SMILES | CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C20H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h19-20,22,24H,3-17H2,1-2H3,(H,21,23)/t19-,20+/m0/s1 |
| InChIKey | CRJGESKKUOMBCT-VQTJNVASSA-N |
| XLogP | 4.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide?
The IUPAC name of N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide (CID 6610273) is N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide.
What is the SMILES notation for N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide?
The canonical SMILES for N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide is CCCCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC(C)=O.
What is the InChIKey of N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide?
The InChIKey is CRJGESKKUOMBCT-VQTJNVASSA-N. The full InChI is InChI=1S/C20H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h19-20,22,24H,3-17H2,1-2H3,(H,21,23)/t19-,20+/m0/s1.
What are the key properties of N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide?
N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide has a molecular weight of 343.55 g/mol, XLogP of 4.33, 17 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-1,3-dihydroxyoctadecan-2-yl]acetamide is sourced from PubChem (CID 6610273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).