About 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol
2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol (PubChem CID 66103307) has the molecular formula C7H12N2OS2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol |
| PubChem CID | 66103307 |
| Molecular Formula | C7H12N2OS2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol |
| SMILES | Cc1nsc(SCC(C)CO)n1 |
| InChI | InChI=1S/C7H12N2OS2/c1-5(3-10)4-11-7-8-6(2)9-12-7/h5,10H,3-4H2,1-2H3 |
| InChIKey | FFQZSHMZAKTDST-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol?
The IUPAC name of 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol (CID 66103307) is 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol.
What is the SMILES notation for 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol?
The canonical SMILES for 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol is Cc1nsc(SCC(C)CO)n1.
What is the InChIKey of 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol?
The InChIKey is FFQZSHMZAKTDST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS2/c1-5(3-10)4-11-7-8-6(2)9-12-7/h5,10H,3-4H2,1-2H3.
What are the key properties of 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol?
2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol has a molecular weight of 204.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]propan-1-ol is sourced from PubChem (CID 66103307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).