C20H18N2O4 — CID 6610399
(2S,11R)-5,7-dimethyl-9,13-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3(8),15,17,19,21-hexaene-4,6-dione (PubChem CID 6610399) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2S,11R)-5,7-dimethyl-9,13-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3(8),15,17,19,21-hexaene-4,6-dione.
| Compound Name | (2S,11R)-5,7-dimethyl-9,13-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3(8),15,17,19,21-hexaene-4,6-dione |
|---|---|
| PubChem CID | 6610399 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2S,11R)-5,7-dimethyl-9,13-dioxa-5,7-diazapentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),3(8),15,17,19,21-hexaene-4,6-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)[C@@H]1c3c(ccc4ccccc34)OC[C@@H]1CO2 |
| InChI | InChI=1S/C20H18N2O4/c1-21-18(23)17-15-12(10-26-19(17)22(2)20(21)24)9-25-14-8-7-11-5-3-4-6-13(11)16(14)15/h3-8,12,15H,9-10H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | BVABHBZKKZEGCF-DOMZBBRYSA-N |
| XLogP | 1.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |