C14H22N2O3S — CID 66104221
N-(4-amino-2-methoxyphenyl)-2-(3-hydroxy-2-methylpropyl)sulfanylpropanamide (PubChem CID 66104221) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-(4-amino-2-methoxyphenyl)-2-(3-hydroxy-2-methylpropyl)sulfanylpropanamide.
| Compound Name | N-(4-amino-2-methoxyphenyl)-2-(3-hydroxy-2-methylpropyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 66104221 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(4-amino-2-methoxyphenyl)-2-(3-hydroxy-2-methylpropyl)sulfanylpropanamide |
| SMILES | COc1cc(N)ccc1NC(=O)C(C)SCC(C)CO |
| InChI | InChI=1S/C14H22N2O3S/c1-9(7-17)8-20-10(2)14(18)16-12-5-4-11(15)6-13(12)19-3/h4-6,9-10,17H,7-8,15H2,1-3H3,(H,16,18) |
| InChIKey | ZDUPINDHWHFEOB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|